About (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine
(Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine (PubChem CID 166811924) has the molecular formula C12H17F2N
and a molecular weight of 213.27 g/mol. Its IUPAC name is (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine.
Molecular Properties
| Compound Name | (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine |
| PubChem CID | 166811924 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine |
| SMILES | [H]/N=C(C(/C=C\CCC)=C/CC=C)\C(F)F |
| InChI | InChI=1S/C12H17F2N/c1-3-5-7-9-10(8-6-4-2)11(15)12(13)14/h4,7-9,12,15H,2-3,5-6H2,1H3/b9-7-,10-8+,15-11- |
| InChIKey | VCIGIEGYOUJGLV-CDMOAURPSA-N |
| XLogP | 4.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine?
The IUPAC name of (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine (CID 166811924) is (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine.
What is the SMILES notation for (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine?
The canonical SMILES for (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine is [H]/N=C(C(/C=C\CCC)=C/CC=C)\C(F)F.
What is the InChIKey of (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine?
The InChIKey is VCIGIEGYOUJGLV-CDMOAURPSA-N. The full InChI is InChI=1S/C12H17F2N/c1-3-5-7-9-10(8-6-4-2)11(15)12(13)14/h4,7-9,12,15H,2-3,5-6H2,1H3/b9-7-,10-8+,15-11-.
What are the key properties of (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine?
(Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine has a molecular weight of 213.27 g/mol, XLogP of 4.13, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3E)-3-but-3-enylidene-1,1-difluorooct-4-en-2-imine is sourced from PubChem (CID 166811924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).