C11H20ClNO — CID 166812063
(2S,3S)-2-(2-chloroprop-2-enyl)-6-propylpiperidin-3-ol (PubChem CID 166812063) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is (2S,3S)-2-(2-chloroprop-2-enyl)-6-propylpiperidin-3-ol.
| Compound Name | (2S,3S)-2-(2-chloroprop-2-enyl)-6-propylpiperidin-3-ol |
|---|---|
| PubChem CID | 166812063 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (2S,3S)-2-(2-chloroprop-2-enyl)-6-propylpiperidin-3-ol |
| SMILES | C=C(Cl)C[C@@H]1NC(CCC)CC[C@@H]1O |
| InChI | InChI=1S/C11H20ClNO/c1-3-4-9-5-6-11(14)10(13-9)7-8(2)12/h9-11,13-14H,2-7H2,1H3/t9?,10-,11-/m0/s1 |
| InChIKey | DOXZHOUGNSQKCG-DVRYWGNFSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |