About (3R)-5-methyl-2,3-dihydrothiophen-3-amine
(3R)-5-methyl-2,3-dihydrothiophen-3-amine (PubChem CID 166812420) has the molecular formula C5H9NS
and a molecular weight of 115.20 g/mol. Its IUPAC name is (3R)-5-methyl-2,3-dihydrothiophen-3-amine.
Molecular Properties
| Compound Name | (3R)-5-methyl-2,3-dihydrothiophen-3-amine |
| PubChem CID | 166812420 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | (3R)-5-methyl-2,3-dihydrothiophen-3-amine |
| SMILES | CC1=C[C@@H](N)CS1 |
| InChI | InChI=1S/C5H9NS/c1-4-2-5(6)3-7-4/h2,5H,3,6H2,1H3/t5-/m1/s1 |
| InChIKey | OVDIRHXMOCRQQZ-RXMQYKEDSA-N |
| XLogP | 0.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-5-methyl-2,3-dihydrothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-methyl-2,3-dihydrothiophen-3-amine?
The IUPAC name of (3R)-5-methyl-2,3-dihydrothiophen-3-amine (CID 166812420) is (3R)-5-methyl-2,3-dihydrothiophen-3-amine.
What is the SMILES notation for (3R)-5-methyl-2,3-dihydrothiophen-3-amine?
The canonical SMILES for (3R)-5-methyl-2,3-dihydrothiophen-3-amine is CC1=C[C@@H](N)CS1.
What is the InChIKey of (3R)-5-methyl-2,3-dihydrothiophen-3-amine?
The InChIKey is OVDIRHXMOCRQQZ-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H9NS/c1-4-2-5(6)3-7-4/h2,5H,3,6H2,1H3/t5-/m1/s1.
What are the key properties of (3R)-5-methyl-2,3-dihydrothiophen-3-amine?
(3R)-5-methyl-2,3-dihydrothiophen-3-amine has a molecular weight of 115.20 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-methyl-2,3-dihydrothiophen-3-amine is sourced from PubChem (CID 166812420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).