C26H36F3N — CID 166812474
7-propan-2-yl-9-(trifluoromethyl)-4-(3,5,5-trimethylcyclohexen-1-yl)-3,4,6,6a,9,10,10a,10b-octahydrobenzo[f]isoquinoline (PubChem CID 166812474) has the molecular formula C26H36F3N and a molecular weight of 419.58 g/mol. Its IUPAC name is 7-propan-2-yl-9-(trifluoromethyl)-4-(3,5,5-trimethylcyclohexen-1-yl)-3,4,6,6a,9,10,10a,10b-octahydrobenzo[f]isoquinoline.
| Compound Name | 7-propan-2-yl-9-(trifluoromethyl)-4-(3,5,5-trimethylcyclohexen-1-yl)-3,4,6,6a,9,10,10a,10b-octahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 166812474 |
| Molecular Formula | C26H36F3N |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 7-propan-2-yl-9-(trifluoromethyl)-4-(3,5,5-trimethylcyclohexen-1-yl)-3,4,6,6a,9,10,10a,10b-octahydrobenzo[f]isoquinoline |
| SMILES | CC1C=C(C2NC=CC3C2=CCC2C(C(C)C)=CC(C(F)(F)F)CC32)CC(C)(C)C1 |
| InChI | InChI=1S/C26H36F3N/c1-15(2)22-11-18(26(27,28)29)12-23-19(22)6-7-21-20(23)8-9-30-24(21)17-10-16(3)13-25(4,5)14-17/h7-11,15-16,18-20,23-24,30H,6,12-14H2,1-5H3 |
| InChIKey | CPNWSGRWJJZUDE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|