C21H18F3N5O3S — CID 166812720
2-[4-[[5-(2,2-difluoroethoxy)-6-fluoro-1H-benzimidazol-2-yl]methyl]-1-oxophthalazin-2-yl]-N-methylsulfanylacetamide (PubChem CID 166812720) has the molecular formula C21H18F3N5O3S and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[4-[[5-(2,2-difluoroethoxy)-6-fluoro-1H-benzimidazol-2-yl]methyl]-1-oxophthalazin-2-yl]-N-methylsulfanylacetamide.
| Compound Name | 2-[4-[[5-(2,2-difluoroethoxy)-6-fluoro-1H-benzimidazol-2-yl]methyl]-1-oxophthalazin-2-yl]-N-methylsulfanylacetamide |
|---|---|
| PubChem CID | 166812720 |
| Molecular Formula | C21H18F3N5O3S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-[4-[[5-(2,2-difluoroethoxy)-6-fluoro-1H-benzimidazol-2-yl]methyl]-1-oxophthalazin-2-yl]-N-methylsulfanylacetamide |
| SMILES | CSNC(=O)Cn1nc(Cc2nc3cc(OCC(F)F)c(F)cc3[nH]2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H18F3N5O3S/c1-33-28-20(30)9-29-21(31)12-5-3-2-4-11(12)14(27-29)8-19-25-15-6-13(22)17(7-16(15)26-19)32-10-18(23)24/h2-7,18H,8-10H2,1H3,(H,25,26)(H,28,30) |
| InChIKey | MTHTVXCVENDXKJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|