C11H21N3 — CID 166812847
1,2-dimethyl-3-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]guanidine (PubChem CID 166812847) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 166812847 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1,2-dimethyl-3-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]guanidine |
| SMILES | CC/C(C)=C\C=C(/C)N/C(=N/C)NC |
| InChI | InChI=1S/C11H21N3/c1-6-9(2)7-8-10(3)14-11(12-4)13-5/h7-8H,6H2,1-5H3,(H2,12,13,14)/b9-7-,10-8+ |
| InChIKey | HBHFLRYMLKMMTN-FKJILZIQSA-N |
| XLogP | 2.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|