C20H19ClF2O4S — CID 16681308
2-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)cyclohexyl]acetic acid (PubChem CID 16681308) has the molecular formula C20H19ClF2O4S and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)cyclohexyl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 16681308 |
| Molecular Formula | C20H19ClF2O4S |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonyl-4-(2,5-difluorophenyl)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2cc(F)ccc2F)(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19ClF2O4S/c21-14-1-4-16(5-2-14)28(26,27)20(17-12-15(22)3-6-18(17)23)9-7-13(8-10-20)11-19(24)25/h1-6,12-13H,7-11H2,(H,24,25) |
| InChIKey | JCCTVKXXDWBDOU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |