About 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one
9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one (PubChem CID 166813200) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one.
Molecular Properties
| Compound Name | 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one |
| PubChem CID | 166813200 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one |
| SMILES | CNc1cc(C)c(CCCCCCC(O)C(C)=O)cc1C |
| InChI | InChI=1S/C18H29NO2/c1-13-12-17(19-4)14(2)11-16(13)9-7-5-6-8-10-18(21)15(3)20/h11-12,18-19,21H,5-10H2,1-4H3 |
| InChIKey | AKFJXTVOCBOQPC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one?
The IUPAC name of 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one (CID 166813200) is 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one.
What is the SMILES notation for 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one?
The canonical SMILES for 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one is CNc1cc(C)c(CCCCCCC(O)C(C)=O)cc1C.
What is the InChIKey of 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one?
The InChIKey is AKFJXTVOCBOQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-13-12-17(19-4)14(2)11-16(13)9-7-5-6-8-10-18(21)15(3)20/h11-12,18-19,21H,5-10H2,1-4H3.
What are the key properties of 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one?
9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one has a molecular weight of 291.44 g/mol, XLogP of 3.79, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,5-dimethyl-4-(methylamino)phenyl]-3-hydroxynonan-2-one is sourced from PubChem (CID 166813200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).