About N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine
N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine (PubChem CID 166813243) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 166813243 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)C1CC=CC=N1 |
| InChI | InChI=1S/C8H15N3/c1-11(7-5-9)8-4-2-3-6-10-8/h2-3,6,8H,4-5,7,9H2,1H3 |
| InChIKey | LDBRVUPHWIAAQQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine (CID 166813243) is N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine is CN(CCN)C1CC=CC=N1.
What is the InChIKey of N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine?
The InChIKey is LDBRVUPHWIAAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-11(7-5-9)8-4-2-3-6-10-8/h2-3,6,8H,4-5,7,9H2,1H3.
What are the key properties of N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine?
N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine has a molecular weight of 153.23 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,3-dihydropyridin-2-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 166813243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).