C24H40O5 — CID 16681371
[(2E,6Z,11S,12R)-7-(acetyloxymethyl)-12-hydroxy-3,11,15-trimethylhexadeca-2,6,14-trienyl] acetate (PubChem CID 16681371) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is [(2E,6Z,11S,12R)-7-(acetyloxymethyl)-12-hydroxy-3,11,15-trimethylhexadeca-2,6,14-trienyl] acetate.
| Compound Name | [(2E,6Z,11S,12R)-7-(acetyloxymethyl)-12-hydroxy-3,11,15-trimethylhexadeca-2,6,14-trienyl] acetate |
|---|---|
| PubChem CID | 16681371 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(2E,6Z,11S,12R)-7-(acetyloxymethyl)-12-hydroxy-3,11,15-trimethylhexadeca-2,6,14-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(/CCC[C@H](C)[C@H](O)CC=C(C)C)COC(C)=O |
| InChI | InChI=1S/C24H40O5/c1-18(2)13-14-24(27)20(4)10-8-12-23(17-29-22(6)26)11-7-9-19(3)15-16-28-21(5)25/h11,13,15,20,24,27H,7-10,12,14,16-17H2,1-6H3/b19-15+,23-11-/t20-,24+/m0/s1 |
| InChIKey | BZAVZICHJGLLNC-YNWBCAHYSA-N |
| XLogP | 5.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|