About 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole
2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole (PubChem CID 166814094) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole.
Analyze 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole?
The IUPAC name of 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole (CID 166814094) is 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole.
What is the SMILES notation for 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole?
The canonical SMILES for 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole is CC1=C(c2ncco2)SC(C)C1.
What is the InChIKey of 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole?
The InChIKey is PBSQSVZUTDQKST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-6-5-7(2)12-8(6)9-10-3-4-11-9/h3-4,7H,5H2,1-2H3.
What are the key properties of 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole?
2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole has a molecular weight of 181.26 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-2,3-dihydrothiophen-5-yl)-1,3-oxazole is sourced from PubChem (CID 166814094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).