C30H35N3O3 — CID 166814282
6-[(3S)-20-cyclobutyl-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1-methylpyridin-2-one (PubChem CID 166814282) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 6-[(3S)-20-cyclobutyl-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 6-[(3S)-20-cyclobutyl-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 166814282 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 6-[(3S)-20-cyclobutyl-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1-methylpyridin-2-one |
| SMILES | Cn1c(C(=O)N2C[C@H]3CC45CCC2C3C42CCN(C3CCC3)C5Cc3ccc(O)cc32)cccc1=O |
| InChI | InChI=1S/C30H35N3O3/c1-31-24(6-3-7-26(31)35)28(36)33-17-19-16-29-11-10-23(33)27(19)30(29)12-13-32(20-4-2-5-20)25(29)14-18-8-9-21(34)15-22(18)30/h3,6-9,15,19-20,23,25,27,34H,2,4-5,10-14,16-17H2,1H3/t19-,23?,25?,27?,29?,30?/m1/s1 |
| InChIKey | VCCRBPBWHWPVKQ-RFJYMUJXSA-N |
| XLogP | 3.45 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |