C15H26O2 — CID 16681440
(1R,2R,4S,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,4,5,6,7,8,8a-octahydroazulen-2-ol (PubChem CID 16681440) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,2R,4S,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,4,5,6,7,8,8a-octahydroazulen-2-ol.
| Compound Name | (1R,2R,4S,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,4,5,6,7,8,8a-octahydroazulen-2-ol |
|---|---|
| PubChem CID | 16681440 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,2R,4S,7R,8aS)-7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,4,5,6,7,8,8a-octahydroazulen-2-ol |
| SMILES | C[C@@H]1[C@@H]2C[C@H](C(C)(C)O)CC[C@H](C)C2=C[C@@H]1O |
| InChI | InChI=1S/C15H26O2/c1-9-5-6-11(15(3,4)17)7-13-10(2)14(16)8-12(9)13/h8-11,13-14,16-17H,5-7H2,1-4H3/t9-,10+,11+,13-,14-/m0/s1 |
| InChIKey | HOIPKOPJTJSELQ-AXMVNOCNSA-N |
| XLogP | 2.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|