About 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole
2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 166814570) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 166814570 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCC1=NCC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C11H12FNO/c1-2-11-13-7-10(14-11)8-3-5-9(12)6-4-8/h3-6,10H,2,7H2,1H3 |
| InChIKey | YYVZFBXDQBORGS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole (CID 166814570) is 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole is CCC1=NCC(c2ccc(F)cc2)O1.
What is the InChIKey of 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The InChIKey is YYVZFBXDQBORGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO/c1-2-11-13-7-10(14-11)8-3-5-9(12)6-4-8/h3-6,10H,2,7H2,1H3.
What are the key properties of 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole has a molecular weight of 193.22 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 166814570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).