About 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine
3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine (PubChem CID 166815108) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine.
Molecular Properties
| Compound Name | 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine |
| PubChem CID | 166815108 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine |
| SMILES | CC(C)/N=C1\NC=CCN1C |
| InChI | InChI=1S/C8H15N3/c1-7(2)10-8-9-5-4-6-11(8)3/h4-5,7H,6H2,1-3H3,(H,9,10) |
| InChIKey | QQWFCILEWWEKLR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine?
The IUPAC name of 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine (CID 166815108) is 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine.
What is the SMILES notation for 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine?
The canonical SMILES for 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine is CC(C)/N=C1\NC=CCN1C.
What is the InChIKey of 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine?
The InChIKey is QQWFCILEWWEKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-7(2)10-8-9-5-4-6-11(8)3/h4-5,7H,6H2,1-3H3,(H,9,10).
What are the key properties of 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine?
3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine has a molecular weight of 153.23 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-propan-2-yl-1,4-dihydropyrimidin-2-imine is sourced from PubChem (CID 166815108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).