About 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide
8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide (PubChem CID 166815291) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide.
Molecular Properties
| Compound Name | 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide |
| PubChem CID | 166815291 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide |
| SMILES | C=CC(=C)N(C)CCCCCCCC(=O)NC |
| InChI | InChI=1S/C14H26N2O/c1-5-13(2)16(4)12-10-8-6-7-9-11-14(17)15-3/h5H,1-2,6-12H2,3-4H3,(H,15,17) |
| InChIKey | KPLXBPUYYXKISN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide?
The IUPAC name of 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide (CID 166815291) is 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide.
What is the SMILES notation for 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide?
The canonical SMILES for 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide is C=CC(=C)N(C)CCCCCCCC(=O)NC.
What is the InChIKey of 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide?
The InChIKey is KPLXBPUYYXKISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-5-13(2)16(4)12-10-8-6-7-9-11-14(17)15-3/h5H,1-2,6-12H2,3-4H3,(H,15,17).
What are the key properties of 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide?
8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide has a molecular weight of 238.37 g/mol, XLogP of 2.70, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[buta-1,3-dien-2-yl(methyl)amino]-N-methyloctanamide is sourced from PubChem (CID 166815291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).