C15H17N3OS — CID 166816032
2-(1-thiophen-2-ylcyclopropyl)-3,5,6,7,8,9-hexahydropyrimido[5,4-c]azepin-4-one (PubChem CID 166816032) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-(1-thiophen-2-ylcyclopropyl)-3,5,6,7,8,9-hexahydropyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-(1-thiophen-2-ylcyclopropyl)-3,5,6,7,8,9-hexahydropyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 166816032 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(1-thiophen-2-ylcyclopropyl)-3,5,6,7,8,9-hexahydropyrimido[5,4-c]azepin-4-one |
| SMILES | O=c1[nH]c(C2(c3cccs3)CC2)nc2c1CNCCC2 |
| InChI | InChI=1S/C15H17N3OS/c19-13-10-9-16-7-1-3-11(10)17-14(18-13)15(5-6-15)12-4-2-8-20-12/h2,4,8,16H,1,3,5-7,9H2,(H,17,18,19) |
| InChIKey | TWMWFMVFTJOAQK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |