C14H18F6O3 — CID 166816208
[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl prop-2-enoate (PubChem CID 166816208) has the molecular formula C14H18F6O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is [3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl prop-2-enoate.
| Compound Name | [3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 166816208 |
| Molecular Formula | C14H18F6O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CCCC(CC(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H18F6O3/c1-2-11(21)23-8-10-5-3-4-9(6-10)7-12(22,13(15,16)17)14(18,19)20/h2,9-10,22H,1,3-8H2 |
| InChIKey | CHIMSAZEOBTWNP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|