C15H22O5 — CID 16681666
(1R,2S,6R,8S,9R,11R,13S,14S)-8,13-dimethyl-3-methylidene-5,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-2,6,14-triol (PubChem CID 16681666) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1R,2S,6R,8S,9R,11R,13S,14S)-8,13-dimethyl-3-methylidene-5,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-2,6,14-triol.
| Compound Name | (1R,2S,6R,8S,9R,11R,13S,14S)-8,13-dimethyl-3-methylidene-5,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-2,6,14-triol |
|---|---|
| PubChem CID | 16681666 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1R,2S,6R,8S,9R,11R,13S,14S)-8,13-dimethyl-3-methylidene-5,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-2,6,14-triol |
| SMILES | C=C1CO[C@]2(O)C[C@H](C)[C@H]3C[C@H]4O[C@@]4(C)[C@@H](O)[C@@H]3[C@]12O |
| InChI | InChI=1S/C15H22O5/c1-7-5-14(17)15(18,8(2)6-19-14)11-9(7)4-10-13(3,20-10)12(11)16/h7,9-12,16-18H,2,4-6H2,1,3H3/t7-,9+,10+,11+,12-,13+,14+,15+/m0/s1 |
| InChIKey | OMSVOJWCTSOIHP-RYIMXZBNSA-N |
| XLogP | 0.19 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|