C26H39N5O4 — CID 166817055
1-(tert-butylamino)-2-[methyl-[2-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]amino]ethanol (PubChem CID 166817055) has the molecular formula C26H39N5O4 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-(tert-butylamino)-2-[methyl-[2-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 1-(tert-butylamino)-2-[methyl-[2-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 166817055 |
| Molecular Formula | C26H39N5O4 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 1-(tert-butylamino)-2-[methyl-[2-[4-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]amino]ethanol |
| SMILES | CN(CC(O)NC(C)(C)C)c1nc(-c2cc(OCCOC3CCCCO3)ccn2)nc2c1CCC2 |
| InChI | InChI=1S/C26H39N5O4/c1-26(2,3)30-22(32)17-31(4)25-19-8-7-9-20(19)28-24(29-25)21-16-18(11-12-27-21)33-14-15-35-23-10-5-6-13-34-23/h11-12,16,22-23,30,32H,5-10,13-15,17H2,1-4H3 |
| InChIKey | VNEKNQRWBCTYKQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|