C19H19F5N2O — CID 166817316
(2S)-8,8'-difluoro-7'-methoxy-8a-methyl-6-(trifluoromethyl)spiro[1,3-dihydroimidazo[1,2-a]pyridine-2,4'-2,3-dihydro-1H-naphthalene] (PubChem CID 166817316) has the molecular formula C19H19F5N2O and a molecular weight of 386.36 g/mol. Its IUPAC name is (2S)-8,8'-difluoro-7'-methoxy-8a-methyl-6-(trifluoromethyl)spiro[1,3-dihydroimidazo[1,2-a]pyridine-2,4'-2,3-dihydro-1H-naphthalene].
| Compound Name | (2S)-8,8'-difluoro-7'-methoxy-8a-methyl-6-(trifluoromethyl)spiro[1,3-dihydroimidazo[1,2-a]pyridine-2,4'-2,3-dihydro-1H-naphthalene] |
|---|---|
| PubChem CID | 166817316 |
| Molecular Formula | C19H19F5N2O |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2S)-8,8'-difluoro-7'-methoxy-8a-methyl-6-(trifluoromethyl)spiro[1,3-dihydroimidazo[1,2-a]pyridine-2,4'-2,3-dihydro-1H-naphthalene] |
| SMILES | COc1ccc2c(c1F)CCC[C@@]21CN2C=C(C(F)(F)F)C=C(F)C2(C)N1 |
| InChI | InChI=1S/C19H19F5N2O/c1-17-15(20)8-11(19(22,23)24)9-26(17)10-18(25-17)7-3-4-12-13(18)5-6-14(27-2)16(12)21/h5-6,8-9,25H,3-4,7,10H2,1-2H3/t17?,18-/m1/s1 |
| InChIKey | CXWXKYYQONUSOW-QRWMCTBCSA-N |
| XLogP | 4.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |