About 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine
2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine (PubChem CID 166817822) has the molecular formula C11H12F3NO2
and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine.
Molecular Properties
| Compound Name | 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine |
| PubChem CID | 166817822 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine |
| SMILES | C=C(OC)[C@@H](Oc1cccc(C)n1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2/c1-7-5-4-6-9(15-7)17-10(8(2)16-3)11(12,13)14/h4-6,10H,2H2,1,3H3/t10-/m1/s1 |
| InChIKey | BZQMAUQIFPKGAX-SNVBAGLBSA-N |
| XLogP | 2.86 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine?
The IUPAC name of 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine (CID 166817822) is 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine.
What is the SMILES notation for 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine?
The canonical SMILES for 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine is C=C(OC)[C@@H](Oc1cccc(C)n1)C(F)(F)F.
What is the InChIKey of 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine?
The InChIKey is BZQMAUQIFPKGAX-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H12F3NO2/c1-7-5-4-6-9(15-7)17-10(8(2)16-3)11(12,13)14/h4-6,10H,2H2,1,3H3/t10-/m1/s1.
What are the key properties of 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine?
2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine has a molecular weight of 247.22 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[(2R)-1,1,1-trifluoro-3-methoxybut-3-en-2-yl]oxypyridine is sourced from PubChem (CID 166817822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).