C13H17F2N — CID 166817890
(3E,5Z,7E)-1,1-difluoro-3-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-2-imine (PubChem CID 166817890) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is (3E,5Z,7E)-1,1-difluoro-3-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-2-imine.
| Compound Name | (3E,5Z,7E)-1,1-difluoro-3-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 166817890 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (3E,5Z,7E)-1,1-difluoro-3-methyl-6-prop-1-en-2-ylnona-3,5,7-trien-2-imine |
| SMILES | [H]/N=C(C(/C)=C/C=C(/C=C/C)C(=C)C)\C(F)F |
| InChI | InChI=1S/C13H17F2N/c1-5-6-11(9(2)3)8-7-10(4)12(16)13(14)15/h5-8,13,16H,2H2,1,3-4H3/b6-5+,10-7+,11-8-,16-12- |
| InChIKey | DTJXKVWMZQMWTB-WRPWMKSQSA-N |
| XLogP | 4.30 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|