C18H29N3 — CID 166818072
(7Z)-7-[(1Z)-buta-1,3-dienyl]-8-ethenyl-4,4,6-trimethyl-2-propan-2-yl-1,5-dihydro-1,3-diazocin-6-amine (PubChem CID 166818072) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (7Z)-7-[(1Z)-buta-1,3-dienyl]-8-ethenyl-4,4,6-trimethyl-2-propan-2-yl-1,5-dihydro-1,3-diazocin-6-amine.
| Compound Name | (7Z)-7-[(1Z)-buta-1,3-dienyl]-8-ethenyl-4,4,6-trimethyl-2-propan-2-yl-1,5-dihydro-1,3-diazocin-6-amine |
|---|---|
| PubChem CID | 166818072 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (7Z)-7-[(1Z)-buta-1,3-dienyl]-8-ethenyl-4,4,6-trimethyl-2-propan-2-yl-1,5-dihydro-1,3-diazocin-6-amine |
| SMILES | C=C/C=C\C1=C(/C=C)N/C(C(C)C)=N\C(C)(C)CC1(C)N |
| InChI | InChI=1S/C18H29N3/c1-8-10-11-14-15(9-2)20-16(13(3)4)21-17(5,6)12-18(14,7)19/h8-11,13H,1-2,12,19H2,3-7H3,(H,20,21)/b11-10-,15-14- |
| InChIKey | RBFWEXWCBDWIEG-JPTBNZNUSA-N |
| XLogP | 3.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|