About 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide
1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide (PubChem CID 16681819) has the molecular formula C18H20Br2N2O
and a molecular weight of 440.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide |
| PubChem CID | 16681819 |
| Molecular Formula | C18H20Br2N2O |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide |
| SMILES | CCCC1=[N+](CC(=O)c2ccc(Br)cc2)CCn2cccc21.[Br-] |
| InChI | InChI=1S/C18H20BrN2O.BrH/c1-2-4-16-17-5-3-10-20(17)11-12-21(16)13-18(22)14-6-8-15(19)9-7-14;/h3,5-10H,2,4,11-13H2,1H3;1H/q+1;/p-1 |
| InChIKey | YCSMNKXIVMFEKV-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 25.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_H(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide?
The IUPAC name of 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide (CID 16681819) is 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide.
What is the SMILES notation for 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide?
The canonical SMILES for 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide is CCCC1=[N+](CC(=O)c2ccc(Br)cc2)CCn2cccc21.[Br-].
What is the InChIKey of 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide?
The InChIKey is YCSMNKXIVMFEKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H20BrN2O.BrH/c1-2-4-16-17-5-3-10-20(17)11-12-21(16)13-18(22)14-6-8-15(19)9-7-14;/h3,5-10H,2,4,11-13H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide?
1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide has a molecular weight of 440.18 g/mol, XLogP of 0.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(1-propyl-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone bromide is sourced from PubChem (CID 16681819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).