About (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine
(E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine (PubChem CID 166818334) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine.
Molecular Properties
| Compound Name | (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine |
| PubChem CID | 166818334 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine |
| SMILES | C=C/C(=C\C)C(=C)C(C)(C)NC |
| InChI | InChI=1S/C11H19N/c1-7-10(8-2)9(3)11(4,5)12-6/h7-8,12H,1,3H2,2,4-6H3/b10-8+ |
| InChIKey | GLYIXCZMEMVXDC-CSKARUKUSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine?
The IUPAC name of (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine (CID 166818334) is (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine.
What is the SMILES notation for (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine?
The canonical SMILES for (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine is C=C/C(=C\C)C(=C)C(C)(C)NC.
What is the InChIKey of (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine?
The InChIKey is GLYIXCZMEMVXDC-CSKARUKUSA-N. The full InChI is InChI=1S/C11H19N/c1-7-10(8-2)9(3)11(4,5)12-6/h7-8,12H,1,3H2,2,4-6H3/b10-8+.
What are the key properties of (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine?
(E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine has a molecular weight of 165.28 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethenyl-N,2-dimethyl-3-methylidenehex-4-en-2-amine is sourced from PubChem (CID 166818334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).