C22H26N4O4 — CID 16681834
(8R)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-[(E)-pent-2-enoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681834) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is (8R)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-[(E)-pent-2-enoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8R)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-[(E)-pent-2-enoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681834 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (8R)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-[(E)-pent-2-enoyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C/C=C\C(=O)Nc1cccc(C2=NOC3(C2)C[C@H](C(N)=O)N(C(=O)/C=C/CC)C3)c1 |
| InChI | InChI=1S/C22H26N4O4/c1-3-5-10-20(28)26-14-22(13-18(26)21(23)29)12-17(25-30-22)15-8-6-9-16(11-15)24-19(27)7-4-2/h4-11,18H,3,12-14H2,1-2H3,(H2,23,29)(H,24,27)/b7-4-,10-5+/t18-,22?/m1/s1 |
| InChIKey | QRFJLVJCGNHDMW-GIVAFFFISA-N |
| XLogP | 2.12 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|