C23H30N4O4 — CID 16681837
(8S)-3-[3-(hexanoylamino)phenyl]-7-(2-methylprop-2-enoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681837) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is (8S)-3-[3-(hexanoylamino)phenyl]-7-(2-methylprop-2-enoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8S)-3-[3-(hexanoylamino)phenyl]-7-(2-methylprop-2-enoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681837 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (8S)-3-[3-(hexanoylamino)phenyl]-7-(2-methylprop-2-enoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C=C(C)C(=O)N1CC2(CC(c3cccc(NC(=O)CCCCC)c3)=NO2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C23H30N4O4/c1-4-5-6-10-20(28)25-17-9-7-8-16(11-17)18-12-23(31-26-18)13-19(21(24)29)27(14-23)22(30)15(2)3/h7-9,11,19H,2,4-6,10,12-14H2,1,3H3,(H2,24,29)(H,25,28)/t19-,23?/m0/s1 |
| InChIKey | VVJWWRSTRZGPSL-HSTJUUNISA-N |
| XLogP | 2.73 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|