C23H30N4O4 — CID 16681842
(8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-hexanoyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681842) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-hexanoyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-hexanoyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681842 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-hexanoyl-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C/C=C\C(=O)Nc1cccc(C2=NOC3(C2)C[C@@H](C(N)=O)N(C(=O)CCCCC)C3)c1 |
| InChI | InChI=1S/C23H30N4O4/c1-3-5-6-11-21(29)27-15-23(14-19(27)22(24)30)13-18(26-31-23)16-9-7-10-17(12-16)25-20(28)8-4-2/h4,7-10,12,19H,3,5-6,11,13-15H2,1-2H3,(H2,24,30)(H,25,28)/b8-4-/t19-,23?/m0/s1 |
| InChIKey | XETOSRAZIGCGML-JYMDFTORSA-N |
| XLogP | 2.73 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|