C32H32N4O4 — CID 16681844
(8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-(3,3-diphenylpropanoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681844) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-(3,3-diphenylpropanoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-(3,3-diphenylpropanoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681844 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (8S)-3-[3-[[(Z)-but-2-enoyl]amino]phenyl]-7-(3,3-diphenylpropanoyl)-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C/C=C\C(=O)Nc1cccc(C2=NOC3(C2)C[C@@H](C(N)=O)N(C(=O)CC(c2ccccc2)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C32H32N4O4/c1-2-10-29(37)34-25-16-9-15-24(17-25)27-19-32(40-35-27)20-28(31(33)39)36(21-32)30(38)18-26(22-11-5-3-6-12-22)23-13-7-4-8-14-23/h2-17,26,28H,18-21H2,1H3,(H2,33,39)(H,34,37)/b10-2-/t28-,32?/m0/s1 |
| InChIKey | RCCHDBDENYQPNM-JSLCVZFWSA-N |
| XLogP | 4.37 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|