About N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride
N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride (PubChem CID 16681847) has the molecular formula C22H30ClNO
and a molecular weight of 359.94 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride |
| PubChem CID | 16681847 |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride |
| SMILES | CC1(C)CC(N(CCc2ccccc2)Cc2ccccc2)CCO1.Cl |
| InChI | InChI=1S/C22H29NO.ClH/c1-22(2)17-21(14-16-24-22)23(18-20-11-7-4-8-12-20)15-13-19-9-5-3-6-10-19;/h3-12,21H,13-18H2,1-2H3;1H |
| InChIKey | WZTDSMYAKCOIOH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride?
The IUPAC name of N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride (CID 16681847) is N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride.
What is the SMILES notation for N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride?
The canonical SMILES for N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride is CC1(C)CC(N(CCc2ccccc2)Cc2ccccc2)CCO1.Cl.
What is the InChIKey of N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride?
The InChIKey is WZTDSMYAKCOIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO.ClH/c1-22(2)17-21(14-16-24-22)23(18-20-11-7-4-8-12-20)15-13-19-9-5-3-6-10-19;/h3-12,21H,13-18H2,1-2H3;1H.
What are the key properties of N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride?
N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride has a molecular weight of 359.94 g/mol, XLogP of 5.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2-dimethyl-N-(2-phenylethyl)oxan-4-amine;hydrochloride is sourced from PubChem (CID 16681847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).