C11H21NO — CID 166818663
8a-(2-methylpropyl)-1,3,4,6,7,8-hexahydropyrrolo[2,1-c][1,4]oxazine (PubChem CID 166818663) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 8a-(2-methylpropyl)-1,3,4,6,7,8-hexahydropyrrolo[2,1-c][1,4]oxazine.
| Compound Name | 8a-(2-methylpropyl)-1,3,4,6,7,8-hexahydropyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 166818663 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 8a-(2-methylpropyl)-1,3,4,6,7,8-hexahydropyrrolo[2,1-c][1,4]oxazine |
| SMILES | CC(C)CC12CCCN1CCOC2 |
| InChI | InChI=1S/C11H21NO/c1-10(2)8-11-4-3-5-12(11)6-7-13-9-11/h10H,3-9H2,1-2H3 |
| InChIKey | NFZIEOUVEJYMIM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |