C21H21F3N2O2 — CID 16681870
N-(4-phenylbutyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 16681870) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is N-(4-phenylbutyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-(4-phenylbutyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16681870 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(4-phenylbutyl)-3-[4-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)C1CC(c2ccc(C(F)(F)F)cc2)=NO1 |
| InChI | InChI=1S/C21H21F3N2O2/c22-21(23,24)17-11-9-16(10-12-17)18-14-19(28-26-18)20(27)25-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,19H,4-5,8,13-14H2,(H,25,27) |
| InChIKey | CMBJSUIBGGTGAZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|