About 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine
1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine (PubChem CID 166818799) has the molecular formula C6H9F2I2NO
and a molecular weight of 402.95 g/mol. Its IUPAC name is 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine |
| PubChem CID | 166818799 |
| Molecular Formula | C6H9F2I2NO |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.87 |
| IUPAC Name | 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine |
| SMILES | FC1(F)CN(CCOC(I)I)C1 |
| InChI | InChI=1S/C6H9F2I2NO/c7-6(8)3-11(4-6)1-2-12-5(9)10/h5H,1-4H2 |
| InChIKey | CRLALWVRYDHFNO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine?
The IUPAC name of 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine (CID 166818799) is 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine.
What is the SMILES notation for 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine?
The canonical SMILES for 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine is FC1(F)CN(CCOC(I)I)C1.
What is the InChIKey of 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine?
The InChIKey is CRLALWVRYDHFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2I2NO/c7-6(8)3-11(4-6)1-2-12-5(9)10/h5H,1-4H2.
What are the key properties of 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine?
1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine has a molecular weight of 402.95 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(diiodomethoxy)ethyl]-3,3-difluoroazetidine is sourced from PubChem (CID 166818799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).