C25H31ClN2O6 — CID 16681898
1,3-bis(4-ethoxyphenyl)-2-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium perchlorate (PubChem CID 16681898) has the molecular formula C25H31ClN2O6 and a molecular weight of 490.98 g/mol. Its IUPAC name is 1,3-bis(4-ethoxyphenyl)-2-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium perchlorate.
| Compound Name | 1,3-bis(4-ethoxyphenyl)-2-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium perchlorate |
|---|---|
| PubChem CID | 16681898 |
| Molecular Formula | C25H31ClN2O6 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 1,3-bis(4-ethoxyphenyl)-2-methyl-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-4-ium perchlorate |
| SMILES | CCOc1ccc(-c2c(C)n(-c3ccc(OCC)cc3)c3[n+]2CCCCC3)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H31N2O2.ClHO4/c1-4-28-22-14-10-20(11-15-22)25-19(3)27(24-9-7-6-8-18-26(24)25)21-12-16-23(17-13-21)29-5-2;2-1(3,4)5/h10-17H,4-9,18H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KBZYZXHTBUNKMK-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 119.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|