C22H22BrClN2O — CID 16681988
2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-phenylethanone bromide (PubChem CID 16681988) has the molecular formula C22H22BrClN2O and a molecular weight of 445.79 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-phenylethanone bromide.
| Compound Name | 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 16681988 |
| Molecular Formula | C22H22BrClN2O |
| Molecular Weight | 445.79 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-phenylethanone bromide |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)cc2)n2c1CCCCC2)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H22ClN2O.BrH/c23-19-12-10-17(11-13-19)20-15-24(22-9-5-2-6-14-25(20)22)16-21(26)18-7-3-1-4-8-18;/h1,3-4,7-8,10-13,15H,2,5-6,9,14,16H2;1H/q+1;/p-1 |
| InChIKey | RKNRQZOEVPMUQT-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.79 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|