About 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium
5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium (PubChem CID 16682001) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium.
Molecular Properties
| Compound Name | 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium |
| PubChem CID | 16682001 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium |
| SMILES | C=CCn1c([O-])c(C(C)=O)c(=O)[nH]c1=O.C[NH+](C)C |
| InChI | InChI=1S/C9H10N2O4.C3H9N/c1-3-4-11-8(14)6(5(2)12)7(13)10-9(11)15;1-4(2)3/h3,14H,1,4H2,2H3,(H,10,13,15);1-3H3 |
| InChIKey | AISUYHJELUZJQB-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium?
The IUPAC name of 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium (CID 16682001) is 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium.
What is the SMILES notation for 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium?
The canonical SMILES for 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium is C=CCn1c([O-])c(C(C)=O)c(=O)[nH]c1=O.C[NH+](C)C.
What is the InChIKey of 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium?
The InChIKey is AISUYHJELUZJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4.C3H9N/c1-3-4-11-8(14)6(5(2)12)7(13)10-9(11)15;1-4(2)3/h3,14H,1,4H2,2H3,(H,10,13,15);1-3H3.
What are the key properties of 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium?
5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium has a molecular weight of 269.30 g/mol, XLogP of -2.24, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2,6-dioxo-3-prop-2-enylpyrimidin-4-olate;trimethylazanium is sourced from PubChem (CID 16682001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).