About 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium
5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium (PubChem CID 16682010) has the molecular formula C17H23N3O4
and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium.
Molecular Properties
| Compound Name | 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium |
| PubChem CID | 16682010 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium |
| SMILES | CCc1ccc(-n2c([O-])c(C(C)=O)c(=O)[nH]c2=O)cc1.C[NH+](C)C |
| InChI | InChI=1S/C14H14N2O4.C3H9N/c1-3-9-4-6-10(7-5-9)16-13(19)11(8(2)17)12(18)15-14(16)20;1-4(2)3/h4-7,19H,3H2,1-2H3,(H,15,18,20);1-3H3 |
| InChIKey | XAAUCNLCSIQUHZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium?
The IUPAC name of 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium (CID 16682010) is 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium.
What is the SMILES notation for 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium?
The canonical SMILES for 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium is CCc1ccc(-n2c([O-])c(C(C)=O)c(=O)[nH]c2=O)cc1.C[NH+](C)C.
What is the InChIKey of 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium?
The InChIKey is XAAUCNLCSIQUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O4.C3H9N/c1-3-9-4-6-10(7-5-9)16-13(19)11(8(2)17)12(18)15-14(16)20;1-4(2)3/h4-7,19H,3H2,1-2H3,(H,15,18,20);1-3H3.
What are the key properties of 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium?
5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium has a molecular weight of 333.39 g/mol, XLogP of -0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3-(4-ethylphenyl)-2,6-dioxopyrimidin-4-olate;trimethylazanium is sourced from PubChem (CID 16682010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).