About 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride
2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride (PubChem CID 16682051) has the molecular formula C16H27ClN2
and a molecular weight of 282.86 g/mol. Its IUPAC name is 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride |
| PubChem CID | 16682051 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride |
| SMILES | CC1CC(CCN)(c2ccccc2)C(C)CN1C.Cl |
| InChI | InChI=1S/C16H26N2.ClH/c1-13-12-18(3)14(2)11-16(13,9-10-17)15-7-5-4-6-8-15;/h4-8,13-14H,9-12,17H2,1-3H3;1H |
| InChIKey | JRQBXCYLDALETE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride (CID 16682051) is 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride is CC1CC(CCN)(c2ccccc2)C(C)CN1C.Cl.
What is the InChIKey of 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride?
The InChIKey is JRQBXCYLDALETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2.ClH/c1-13-12-18(3)14(2)11-16(13,9-10-17)15-7-5-4-6-8-15;/h4-8,13-14H,9-12,17H2,1-3H3;1H.
What are the key properties of 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride?
2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride has a molecular weight of 282.86 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,5-trimethyl-4-phenylpiperidin-4-yl)ethanamine;hydrochloride is sourced from PubChem (CID 16682051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).