About phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride
phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride (PubChem CID 16682066) has the molecular formula C16H24ClN
and a molecular weight of 265.83 g/mol. Its IUPAC name is phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride.
Molecular Properties
| Compound Name | phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride |
| PubChem CID | 16682066 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride |
| SMILES | CC1(C)C2CCC1(C)C([NH2+]c1ccccc1)C2.[Cl-] |
| InChI | InChI=1S/C16H23N.ClH/c1-15(2)12-9-10-16(15,3)14(11-12)17-13-7-5-4-6-8-13;/h4-8,12,14,17H,9-11H2,1-3H3;1H |
| InChIKey | ZMCBDXJHIQMVJO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride?
The IUPAC name of phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride (CID 16682066) is phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride.
What is the SMILES notation for phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride?
The canonical SMILES for phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride is CC1(C)C2CCC1(C)C([NH2+]c1ccccc1)C2.[Cl-].
What is the InChIKey of phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride?
The InChIKey is ZMCBDXJHIQMVJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N.ClH/c1-15(2)12-9-10-16(15,3)14(11-12)17-13-7-5-4-6-8-13;/h4-8,12,14,17H,9-11H2,1-3H3;1H.
What are the key properties of phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride?
phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride has a molecular weight of 265.83 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)azanium chloride is sourced from PubChem (CID 16682066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).