C15H19N2O2P — CID 166820791
(4aR,5R,8aR)-2-(cyclopropylmethyl)-5-methyl-1,6-dioxo-8a-phosphanyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 166820791) has the molecular formula C15H19N2O2P and a molecular weight of 290.30 g/mol. Its IUPAC name is (4aR,5R,8aR)-2-(cyclopropylmethyl)-5-methyl-1,6-dioxo-8a-phosphanyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aR,5R,8aR)-2-(cyclopropylmethyl)-5-methyl-1,6-dioxo-8a-phosphanyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 166820791 |
| Molecular Formula | C15H19N2O2P |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (4aR,5R,8aR)-2-(cyclopropylmethyl)-5-methyl-1,6-dioxo-8a-phosphanyl-3,4,4a,5-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(P)C(=O)N(CC3CC3)CC[C@H]12 |
| InChI | InChI=1S/C15H19N2O2P/c1-9-12-4-5-17(8-10-2-3-10)14(19)15(12,20)6-11(7-16)13(9)18/h6,9-10,12H,2-5,8,20H2,1H3/t9-,12-,15+/m1/s1 |
| InChIKey | IZWHPVGEXHCYRW-BCQZVRRWSA-N |
| XLogP | 1.53 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|