About 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine
4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine (PubChem CID 16682113) has the molecular formula C21H23ClN4O
and a molecular weight of 382.90 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine |
| PubChem CID | 16682113 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine |
| SMILES | CC(C)c1cc(-c2cc(-c3ccc(Cl)cc3)on2)nc(NC2CCCC2)n1 |
| InChI | InChI=1S/C21H23ClN4O/c1-13(2)17-11-18(25-21(24-17)23-16-5-3-4-6-16)19-12-20(27-26-19)14-7-9-15(22)10-8-14/h7-13,16H,3-6H2,1-2H3,(H,23,24,25) |
| InChIKey | PTVHSHMKGRXPLF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine?
The IUPAC name of 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine (CID 16682113) is 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine.
What is the SMILES notation for 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine?
The canonical SMILES for 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine is CC(C)c1cc(-c2cc(-c3ccc(Cl)cc3)on2)nc(NC2CCCC2)n1.
What is the InChIKey of 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine?
The InChIKey is PTVHSHMKGRXPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClN4O/c1-13(2)17-11-18(25-21(24-17)23-16-5-3-4-6-16)19-12-20(27-26-19)14-7-9-15(22)10-8-14/h7-13,16H,3-6H2,1-2H3,(H,23,24,25).
What are the key properties of 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine?
4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine has a molecular weight of 382.90 g/mol, XLogP of 5.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-cyclopentyl-6-propan-2-ylpyrimidin-2-amine is sourced from PubChem (CID 16682113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).