About ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride
ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride (PubChem CID 16682153) has the molecular formula C21H26ClNO2
and a molecular weight of 359.90 g/mol. Its IUPAC name is ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride |
| PubChem CID | 16682153 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)[C@@H]1CCN(Cc2ccccc2)C[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C21H25NO2.ClH/c1-2-24-21(23)19-13-14-22(15-17-9-5-3-6-10-17)16-20(19)18-11-7-4-8-12-18;/h3-12,19-20H,2,13-16H2,1H3;1H/t19-,20+;/m1./s1 |
| InChIKey | ZOVBQEWSJYYKFM-FDOHDBATSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride?
The IUPAC name of ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride (CID 16682153) is ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride?
The canonical SMILES for ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride is CCOC(=O)[C@@H]1CCN(Cc2ccccc2)C[C@H]1c1ccccc1.Cl.
What is the InChIKey of ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride?
The InChIKey is ZOVBQEWSJYYKFM-FDOHDBATSA-N. The full InChI is InChI=1S/C21H25NO2.ClH/c1-2-24-21(23)19-13-14-22(15-17-9-5-3-6-10-17)16-20(19)18-11-7-4-8-12-18;/h3-12,19-20H,2,13-16H2,1H3;1H/t19-,20+;/m1./s1.
What are the key properties of ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride?
ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride has a molecular weight of 359.90 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,4R)-1-benzyl-3-phenylpiperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 16682153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).