C22H12ClF2N3O2S — CID 166821545
N-[3-(2-chloro-4,5-difluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-1,2-benzothiazole-3-carboxamide (PubChem CID 166821545) has the molecular formula C22H12ClF2N3O2S and a molecular weight of 455.87 g/mol. Its IUPAC name is N-[3-(2-chloro-4,5-difluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-1,2-benzothiazole-3-carboxamide.
| Compound Name | N-[3-(2-chloro-4,5-difluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 166821545 |
| Molecular Formula | C22H12ClF2N3O2S |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-[3-(2-chloro-4,5-difluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-1,2-benzothiazole-3-carboxamide |
| SMILES | O=C1NC(c2cc(F)c(F)cc2Cl)c2c(NC(=O)c3nsc4ccccc34)cccc21 |
| InChI | InChI=1S/C22H12ClF2N3O2S/c23-13-9-15(25)14(24)8-12(13)19-18-11(21(29)27-19)5-3-6-16(18)26-22(30)20-10-4-1-2-7-17(10)31-28-20/h1-9,19H,(H,26,30)(H,27,29) |
| InChIKey | KDLPQOJQLFNNGH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|