C36H30ClFN6O4 — CID 166822161
5-(2-chloro-5-fluorophenyl)-4-[(2,4-dimethoxyphenyl)methylamino]-6-[(4-methoxyphenyl)methyl]-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 166822161) has the molecular formula C36H30ClFN6O4 and a molecular weight of 665.13 g/mol. Its IUPAC name is 5-(2-chloro-5-fluorophenyl)-4-[(2,4-dimethoxyphenyl)methylamino]-6-[(4-methoxyphenyl)methyl]-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | 5-(2-chloro-5-fluorophenyl)-4-[(2,4-dimethoxyphenyl)methylamino]-6-[(4-methoxyphenyl)methyl]-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 166822161 |
| Molecular Formula | C36H30ClFN6O4 |
| Molecular Weight | 665.13 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | 5-(2-chloro-5-fluorophenyl)-4-[(2,4-dimethoxyphenyl)methylamino]-6-[(4-methoxyphenyl)methyl]-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | COc1ccc(CN2C(=O)c3nc(-c4ccc5ncnn5c4)cc(NCc4ccc(OC)cc4OC)c3C2c2cc(F)ccc2Cl)cc1 |
| InChI | InChI=1S/C36H30ClFN6O4/c1-46-25-9-4-21(5-10-25)18-43-35(27-14-24(38)8-12-28(27)37)33-30(39-17-22-6-11-26(47-2)15-31(22)48-3)16-29(42-34(33)36(43)45)23-7-13-32-40-20-41-44(32)19-23/h4-16,19-20,35H,17-18H2,1-3H3,(H,39,42) |
| InChIKey | SZIXSLPIXWTGNQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.13 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |