About 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one
4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 166822289) has the molecular formula C22H18Cl2N2O2
and a molecular weight of 413.30 g/mol. Its IUPAC name is 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| PubChem CID | 166822289 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | COc1ccc(CN2C(=O)c3cc(Cl)nc(Cl)c3C2c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c1-13-5-3-4-6-16(13)20-19-17(11-18(23)25-21(19)24)22(27)26(20)12-14-7-9-15(28-2)10-8-14/h3-11,20H,12H2,1-2H3 |
| InChIKey | DSVDJSYLEDYXAD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The IUPAC name of 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (CID 166822289) is 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
What is the SMILES notation for 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The canonical SMILES for 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one is COc1ccc(CN2C(=O)c3cc(Cl)nc(Cl)c3C2c2ccccc2C)cc1.
What is the InChIKey of 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
The InChIKey is DSVDJSYLEDYXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N2O2/c1-13-5-3-4-6-16(13)20-19-17(11-18(23)25-21(19)24)22(27)26(20)12-14-7-9-15(28-2)10-8-14/h3-11,20H,12H2,1-2H3.
What are the key properties of 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one?
4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one has a molecular weight of 413.30 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one is sourced from PubChem (CID 166822289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).