C22H18Cl2N2O2 — CID 166822289
4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 166822289) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 166822289 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 4,6-dichloro-2-[(4-methoxyphenyl)methyl]-3-(2-methylphenyl)-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | COc1ccc(CN2C(=O)c3cc(Cl)nc(Cl)c3C2c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c1-13-5-3-4-6-16(13)20-19-17(11-18(23)25-21(19)24)22(27)26(20)12-14-7-9-15(28-2)10-8-14/h3-11,20H,12H2,1-2H3 |
| InChIKey | DSVDJSYLEDYXAD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|