About 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide
4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide (PubChem CID 16682232) has the molecular formula C13H11BrN2O
and a molecular weight of 291.15 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide |
| PubChem CID | 16682232 |
| Molecular Formula | C13H11BrN2O |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide |
| SMILES | Br.Oc1ccc(-c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C13H10N2O.BrH/c16-11-6-4-10(5-7-11)12-9-15-8-2-1-3-13(15)14-12;/h1-9,16H;1H |
| InChIKey | YOXYKHDUBCDAEI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide?
The IUPAC name of 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide (CID 16682232) is 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide is Br.Oc1ccc(-c2cn3ccccc3n2)cc1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide?
The InChIKey is YOXYKHDUBCDAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O.BrH/c16-11-6-4-10(5-7-11)12-9-15-8-2-1-3-13(15)14-12;/h1-9,16H;1H.
What are the key properties of 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide?
4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide has a molecular weight of 291.15 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-2-ylphenol;hydrobromide is sourced from PubChem (CID 16682232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).