C18H17BrN2S — CID 16682235
6-(4-methylphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 16682235) has the molecular formula C18H17BrN2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 6-(4-methylphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 6-(4-methylphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 16682235 |
| Molecular Formula | C18H17BrN2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 6-(4-methylphenyl)-7-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | Cc1ccc(-c2c[n+]3c(n2-c2ccccc2)SCC3)cc1.[Br-] |
| InChI | InChI=1S/C18H17N2S.BrH/c1-14-7-9-15(10-8-14)17-13-19-11-12-21-18(19)20(17)16-5-3-2-4-6-16;/h2-10,13H,11-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | OZTHKHBRHDBROR-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|