About (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile
(2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile (PubChem CID 166822412) has the molecular formula C8H12F2N2S
and a molecular weight of 206.26 g/mol. Its IUPAC name is (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile.
Molecular Properties
| Compound Name | (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile |
| PubChem CID | 166822412 |
| Molecular Formula | C8H12F2N2S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile |
| SMILES | N#C[C@@H](NS)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H12F2N2S/c9-8(10)3-1-6(2-4-8)7(5-11)12-13/h6-7,12-13H,1-4H2/t7-/m1/s1 |
| InChIKey | YZAARFMQPZSSOF-SSDOTTSWSA-N |
| XLogP | 2.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile?
The IUPAC name of (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile (CID 166822412) is (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile.
What is the SMILES notation for (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile?
The canonical SMILES for (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile is N#C[C@@H](NS)C1CCC(F)(F)CC1.
What is the InChIKey of (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile?
The InChIKey is YZAARFMQPZSSOF-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12F2N2S/c9-8(10)3-1-6(2-4-8)7(5-11)12-13/h6-7,12-13H,1-4H2/t7-/m1/s1.
What are the key properties of (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile?
(2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile has a molecular weight of 206.26 g/mol, XLogP of 2.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,4-difluorocyclohexyl)-2-(sulfanylamino)acetonitrile is sourced from PubChem (CID 166822412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).