C21H10BrCl3F2N2O2 — CID 166822504
N-[6-bromo-3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-2,5-dichloro-3-fluorobenzamide (PubChem CID 166822504) has the molecular formula C21H10BrCl3F2N2O2 and a molecular weight of 546.58 g/mol. Its IUPAC name is N-[6-bromo-3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-2,5-dichloro-3-fluorobenzamide.
| Compound Name | N-[6-bromo-3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-2,5-dichloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 166822504 |
| Molecular Formula | C21H10BrCl3F2N2O2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 543.90 |
| IUPAC Name | N-[6-bromo-3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-2,5-dichloro-3-fluorobenzamide |
| SMILES | O=C(Nc1cc(Br)cc2c1C(c1cc(F)ccc1Cl)NC2=O)c1cc(Cl)cc(F)c1Cl |
| InChI | InChI=1S/C21H10BrCl3F2N2O2/c22-8-3-12-17(19(29-20(12)30)11-7-10(26)1-2-14(11)24)16(4-8)28-21(31)13-5-9(23)6-15(27)18(13)25/h1-7,19H,(H,28,31)(H,29,30) |
| InChIKey | WAFDGNBQIBDPHZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|